C18H29N5O5S — CID 21131918
2-(butylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-3-hydroxypropanamide (PubChem CID 21131918) has the molecular formula C18H29N5O5S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-3-hydroxypropanamide.
| Compound Name | 2-(butylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 21131918 |
| Molecular Formula | C18H29N5O5S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-(butylsulfonylamino)-N-[1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-3-hydroxypropanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(C)NC(=O)C(CO)NS(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C18H29N5O5S/c1-3-4-9-29(27,28)23-15(11-24)18(26)22-12(2)17(25)21-10-13-5-7-14(8-6-13)16(19)20/h5-8,12,15,23-24H,3-4,9-11H2,1-2H3,(H3,19,20)(H,21,25)(H,22,26) |
| InChIKey | GDNHYCQJIXDFDC-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|