C22H35N5O7S — CID 10118509
[(2R)-2-(butylsulfonylamino)-3-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-3-oxopropyl] propan-2-yl carbonate (PubChem CID 10118509) has the molecular formula C22H35N5O7S and a molecular weight of 513.62 g/mol. Its IUPAC name is [(2R)-2-(butylsulfonylamino)-3-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-3-oxopropyl] propan-2-yl carbonate.
| Compound Name | [(2R)-2-(butylsulfonylamino)-3-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-3-oxopropyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 10118509 |
| Molecular Formula | C22H35N5O7S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | [(2R)-2-(butylsulfonylamino)-3-[[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]amino]-3-oxopropyl] propan-2-yl carbonate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@@H](COC(=O)OC(C)C)NS(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C22H35N5O7S/c1-5-6-11-35(31,32)27-18(13-33-22(30)34-14(2)3)21(29)26-15(4)20(28)25-12-16-7-9-17(10-8-16)19(23)24/h7-10,14-15,18,27H,5-6,11-13H2,1-4H3,(H3,23,24)(H,25,28)(H,26,29)/t15-,18+/m0/s1 |
| InChIKey | XAHJEVQJHMLMTC-MAUKXSAKSA-N |
| XLogP | 0.74 |
| TPSA | 189.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|