C23H30N4O6S — CID 139659403
methyl (2S)-2-(butylsulfonylamino)-3-[4-[[2-(4-carbamimidoylphenoxy)acetyl]amino]phenyl]propanoate (PubChem CID 139659403) has the molecular formula C23H30N4O6S and a molecular weight of 490.58 g/mol. Its IUPAC name is methyl (2S)-2-(butylsulfonylamino)-3-[4-[[2-(4-carbamimidoylphenoxy)acetyl]amino]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(butylsulfonylamino)-3-[4-[[2-(4-carbamimidoylphenoxy)acetyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 139659403 |
| Molecular Formula | C23H30N4O6S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | methyl (2S)-2-(butylsulfonylamino)-3-[4-[[2-(4-carbamimidoylphenoxy)acetyl]amino]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(OCC(=O)Nc2ccc(C[C@H](NS(=O)(=O)CCCC)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C23H30N4O6S/c1-3-4-13-34(30,31)27-20(23(29)32-2)14-16-5-9-18(10-6-16)26-21(28)15-33-19-11-7-17(8-12-19)22(24)25/h5-12,20,27H,3-4,13-15H2,1-2H3,(H3,24,25)(H,26,28)/t20-/m0/s1 |
| InChIKey | GCTYRTXLEORKIF-FQEVSTJZSA-N |
| XLogP | 1.79 |
| TPSA | 160.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|