C22H27N5O6S — CID 67686904
(2S)-2-(butylsulfonylamino)-3-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenyl]propanoic acid (PubChem CID 67686904) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is (2S)-2-(butylsulfonylamino)-3-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenyl]propanoic acid.
| Compound Name | (2S)-2-(butylsulfonylamino)-3-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67686904 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (2S)-2-(butylsulfonylamino)-3-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(=O)Nc2ccc(C[C@H](NS(=O)(=O)CCCC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H27N5O6S/c1-2-3-12-34(32,33)27-18(21(29)30)13-14-4-10-17(11-5-14)25-22(31)26-20(28)16-8-6-15(7-9-16)19(23)24/h4-11,18,27H,2-3,12-13H2,1H3,(H3,23,24)(H,29,30)(H2,25,26,28,31)/t18-/m0/s1 |
| InChIKey | JACFJDTUACUBML-SFHVURJKSA-N |
| XLogP | 1.65 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|