C18H18N4O5 — CID 67686997
2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenoxy]propanoic acid (PubChem CID 67686997) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenoxy]propanoic acid.
| Compound Name | 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67686997 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[4-[(4-carbamimidoylbenzoyl)carbamoylamino]phenoxy]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(=O)Nc2ccc(OC(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H18N4O5/c1-10(17(24)25)27-14-8-6-13(7-9-14)21-18(26)22-16(23)12-4-2-11(3-5-12)15(19)20/h2-10H,1H3,(H3,19,20)(H,24,25)(H2,21,22,23,26) |
| InChIKey | JZMJMRCCVDXELU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|