C14H21N3O — CID 143855441
N-(4-carbamimidoylphenyl)-2,3,3-trimethylbutanamide (PubChem CID 143855441) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-2,3,3-trimethylbutanamide.
| Compound Name | N-(4-carbamimidoylphenyl)-2,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 143855441 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-2,3,3-trimethylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21N3O/c1-9(14(2,3)4)13(18)17-11-7-5-10(6-8-11)12(15)16/h5-9H,1-4H3,(H3,15,16)(H,17,18) |
| InChIKey | ZFPKWPQNJTTWBH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|