C43H75N3O — CID 138500389
(Z)-N-(4-carbamimidoylphenyl)-2-[(Z)-hexadec-7-enyl]icos-11-enamide (PubChem CID 138500389) has the molecular formula C43H75N3O and a molecular weight of 650.09 g/mol. Its IUPAC name is (Z)-N-(4-carbamimidoylphenyl)-2-[(Z)-hexadec-7-enyl]icos-11-enamide.
| Compound Name | (Z)-N-(4-carbamimidoylphenyl)-2-[(Z)-hexadec-7-enyl]icos-11-enamide |
|---|---|
| PubChem CID | 138500389 |
| Molecular Formula | C43H75N3O |
| Molecular Weight | 650.09 g/mol |
| Exact Mass | 649.59 |
| IUPAC Name | (Z)-N-(4-carbamimidoylphenyl)-2-[(Z)-hexadec-7-enyl]icos-11-enamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(CCCCCC/C=C\CCCCCCCC)CCCCCCCC/C=C\CCCCCCCC)cc1 |
| InChI | InChI=1S/C43H75N3O/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-40(43(47)46-41-37-35-39(36-38-41)42(44)45)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h17-19,21,35-38,40H,3-16,20,22-34H2,1-2H3,(H3,44,45)(H,46,47)/b19-17-,21-18- |
| InChIKey | QANSAZKAVMODIF-HWSICPKZSA-N |
| XLogP | 13.60 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.09 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|