C39H69N3O3 — CID 19030364
3,5-bis(2-hexyldecanoylamino)benzamide (PubChem CID 19030364) has the molecular formula C39H69N3O3 and a molecular weight of 628.00 g/mol. Its IUPAC name is 3,5-bis(2-hexyldecanoylamino)benzamide.
| Compound Name | 3,5-bis(2-hexyldecanoylamino)benzamide |
|---|---|
| PubChem CID | 19030364 |
| Molecular Formula | C39H69N3O3 |
| Molecular Weight | 628.00 g/mol |
| Exact Mass | 627.53 |
| IUPAC Name | 3,5-bis(2-hexyldecanoylamino)benzamide |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)Nc1cc(NC(=O)C(CCCCCC)CCCCCCCC)cc(C(N)=O)c1 |
| InChI | InChI=1S/C39H69N3O3/c1-5-9-13-17-19-23-27-32(25-21-15-11-7-3)38(44)41-35-29-34(37(40)43)30-36(31-35)42-39(45)33(26-22-16-12-8-4)28-24-20-18-14-10-6-2/h29-33H,5-28H2,1-4H3,(H2,40,43)(H,41,44)(H,42,45) |
| InChIKey | WHZGSZWVDQRUDS-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.00 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|