C43H66N2O8 — CID 146333454
2-[7,13-bis[(3-hydroxyphenyl)carbamoyl]octadecyl]-9-methyldecanedioic acid (PubChem CID 146333454) has the molecular formula C43H66N2O8 and a molecular weight of 739.01 g/mol. Its IUPAC name is 2-[7,13-bis[(3-hydroxyphenyl)carbamoyl]octadecyl]-9-methyldecanedioic acid.
| Compound Name | 2-[7,13-bis[(3-hydroxyphenyl)carbamoyl]octadecyl]-9-methyldecanedioic acid |
|---|---|
| PubChem CID | 146333454 |
| Molecular Formula | C43H66N2O8 |
| Molecular Weight | 739.01 g/mol |
| Exact Mass | 738.48 |
| IUPAC Name | 2-[7,13-bis[(3-hydroxyphenyl)carbamoyl]octadecyl]-9-methyldecanedioic acid |
| SMILES | CCCCCC(CCCCCC(CCCCCCC(CCCCCCC(C)C(=O)O)C(=O)O)C(=O)Nc1cccc(O)c1)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C43H66N2O8/c1-3-4-10-20-33(40(48)44-36-26-17-28-38(46)30-36)22-15-9-16-23-34(41(49)45-37-27-18-29-39(47)31-37)21-12-7-8-14-25-35(43(52)53)24-13-6-5-11-19-32(2)42(50)51/h17-18,26-35,46-47H,3-16,19-25H2,1-2H3,(H,44,48)(H,45,49)(H,50,51)(H,52,53) |
| InChIKey | FFMXPYBSROHGJW-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.01 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|