C17H28N2O4 — CID 21117438
tert-butylcarbamic acid;N-(3-hydroxyphenyl)-2-methylpentanamide (PubChem CID 21117438) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butylcarbamic acid;N-(3-hydroxyphenyl)-2-methylpentanamide.
| Compound Name | tert-butylcarbamic acid;N-(3-hydroxyphenyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 21117438 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butylcarbamic acid;N-(3-hydroxyphenyl)-2-methylpentanamide |
| SMILES | CC(C)(C)NC(=O)O.CCCC(C)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C12H17NO2.C5H11NO2/c1-3-5-9(2)12(15)13-10-6-4-7-11(14)8-10;1-5(2,3)6-4(7)8/h4,6-9,14H,3,5H2,1-2H3,(H,13,15);6H,1-3H3,(H,7,8) |
| InChIKey | SKMHNFKJKYOWSO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |