About 2-hexyloctanamide
2-hexyloctanamide (PubChem CID 87302701) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-hexyloctanamide.
Molecular Properties
| Compound Name | 2-hexyloctanamide |
| PubChem CID | 87302701 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-hexyloctanamide |
| SMILES | CCCCCCC(CCCCCC)C(N)=O |
| InChI | InChI=1S/C14H29NO/c1-3-5-7-9-11-13(14(15)16)12-10-8-6-4-2/h13H,3-12H2,1-2H3,(H2,15,16) |
| InChIKey | QSVRQKNANWOTFK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyloctanamide?
The IUPAC name of 2-hexyloctanamide (CID 87302701) is 2-hexyloctanamide.
What is the SMILES notation for 2-hexyloctanamide?
The canonical SMILES for 2-hexyloctanamide is CCCCCCC(CCCCCC)C(N)=O.
What is the InChIKey of 2-hexyloctanamide?
The InChIKey is QSVRQKNANWOTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-3-5-7-9-11-13(14(15)16)12-10-8-6-4-2/h13H,3-12H2,1-2H3,(H2,15,16).
What are the key properties of 2-hexyloctanamide?
2-hexyloctanamide has a molecular weight of 227.39 g/mol, XLogP of 4.03, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyloctanamide is sourced from PubChem (CID 87302701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).