About acetic acid;2-butylhexadecanamide
acetic acid;2-butylhexadecanamide (PubChem CID 174441858) has the molecular formula C22H45NO3
and a molecular weight of 371.61 g/mol. Its IUPAC name is acetic acid;2-butylhexadecanamide.
Molecular Properties
| Compound Name | acetic acid;2-butylhexadecanamide |
| PubChem CID | 174441858 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | acetic acid;2-butylhexadecanamide |
| SMILES | CC(=O)O.CCCCCCCCCCCCCCC(CCCC)C(N)=O |
| InChI | InChI=1S/C20H41NO.C2H4O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-19(20(21)22)17-6-4-2;1-2(3)4/h19H,3-18H2,1-2H3,(H2,21,22);1H3,(H,3,4) |
| InChIKey | KQFJCATZZLSBPA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-butylhexadecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-butylhexadecanamide?
The IUPAC name of acetic acid;2-butylhexadecanamide (CID 174441858) is acetic acid;2-butylhexadecanamide.
What is the SMILES notation for acetic acid;2-butylhexadecanamide?
The canonical SMILES for acetic acid;2-butylhexadecanamide is CC(=O)O.CCCCCCCCCCCCCCC(CCCC)C(N)=O.
What is the InChIKey of acetic acid;2-butylhexadecanamide?
The InChIKey is KQFJCATZZLSBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO.C2H4O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-19(20(21)22)17-6-4-2;1-2(3)4/h19H,3-18H2,1-2H3,(H2,21,22);1H3,(H,3,4).
What are the key properties of acetic acid;2-butylhexadecanamide?
acetic acid;2-butylhexadecanamide has a molecular weight of 371.61 g/mol, XLogP of 6.46, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-butylhexadecanamide is sourced from PubChem (CID 174441858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).