About 7-carbamoylpentadecanoic acid
7-carbamoylpentadecanoic acid (PubChem CID 140987363) has the molecular formula C16H31NO3
and a molecular weight of 285.43 g/mol. Its IUPAC name is 7-carbamoylpentadecanoic acid.
Molecular Properties
| Compound Name | 7-carbamoylpentadecanoic acid |
| PubChem CID | 140987363 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 7-carbamoylpentadecanoic acid |
| SMILES | CCCCCCCCC(CCCCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C16H31NO3/c1-2-3-4-5-6-8-11-14(16(17)20)12-9-7-10-13-15(18)19/h14H,2-13H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | KKWFAPSTHXYZHK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-carbamoylpentadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-carbamoylpentadecanoic acid?
The IUPAC name of 7-carbamoylpentadecanoic acid (CID 140987363) is 7-carbamoylpentadecanoic acid.
What is the SMILES notation for 7-carbamoylpentadecanoic acid?
The canonical SMILES for 7-carbamoylpentadecanoic acid is CCCCCCCCC(CCCCCC(=O)O)C(N)=O.
What is the InChIKey of 7-carbamoylpentadecanoic acid?
The InChIKey is KKWFAPSTHXYZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3/c1-2-3-4-5-6-8-11-14(16(17)20)12-9-7-10-13-15(18)19/h14H,2-13H2,1H3,(H2,17,20)(H,18,19).
What are the key properties of 7-carbamoylpentadecanoic acid?
7-carbamoylpentadecanoic acid has a molecular weight of 285.43 g/mol, XLogP of 3.87, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-carbamoylpentadecanoic acid is sourced from PubChem (CID 140987363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).