C10H12N4O2 — CID 142702544
N'-(4-carbamimidoylphenyl)propanediamide (PubChem CID 142702544) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N'-(4-carbamimidoylphenyl)propanediamide.
| Compound Name | N'-(4-carbamimidoylphenyl)propanediamide |
|---|---|
| PubChem CID | 142702544 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N'-(4-carbamimidoylphenyl)propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C10H12N4O2/c11-8(15)5-9(16)14-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2,(H2,11,15)(H3,12,13)(H,14,16) |
| InChIKey | KGNQHIXMKSUKSM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|