C23H22N4O2 — CID 59110671
N'-(4-carbamimidoylphenyl)-N-[(2-phenylphenyl)methyl]propanediamide (PubChem CID 59110671) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N'-(4-carbamimidoylphenyl)-N-[(2-phenylphenyl)methyl]propanediamide.
| Compound Name | N'-(4-carbamimidoylphenyl)-N-[(2-phenylphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 59110671 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N'-(4-carbamimidoylphenyl)-N-[(2-phenylphenyl)methyl]propanediamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NCc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c24-23(25)17-10-12-19(13-11-17)27-22(29)14-21(28)26-15-18-8-4-5-9-20(18)16-6-2-1-3-7-16/h1-13H,14-15H2,(H3,24,25)(H,26,28)(H,27,29) |
| InChIKey | VBWXGXDZGSQBBR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|