C21H19N3O — CID 73051218
N-[(4-carbamimidoylphenyl)methyl]-2-phenylbenzamide (PubChem CID 73051218) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-phenylbenzamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 73051218 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-phenylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19N3O/c22-20(23)17-12-10-15(11-13-17)14-24-21(25)19-9-5-4-8-18(19)16-6-2-1-3-7-16/h1-13H,14H2,(H3,22,23)(H,24,25) |
| InChIKey | VXNFUCOMWBXEOY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|