C10H13N3O — CID 16744801
N-[(4-carbamimidoylphenyl)methyl]acetamide (PubChem CID 16744801) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]acetamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 16744801 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C10H13N3O/c1-7(14)13-6-8-2-4-9(5-3-8)10(11)12/h2-5H,6H2,1H3,(H3,11,12)(H,13,14) |
| InChIKey | YLTXQTDCTVLDLJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|