C22H26N4O2 — CID 10667379
trans-(1R,2R)-2-N-benzyl-1-N-[(4-carbamimidoylphenyl)methyl]cyclopentane-1,2-dicarboxamide (PubChem CID 10667379) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-benzyl-1-N-[(4-carbamimidoylphenyl)methyl]cyclopentane-1,2-dicarboxamide.
| Compound Name | trans-(1R,2R)-2-N-benzyl-1-N-[(4-carbamimidoylphenyl)methyl]cyclopentane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10667379 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | trans-(1R,2R)-2-N-benzyl-1-N-[(4-carbamimidoylphenyl)methyl]cyclopentane-1,2-dicarboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCC[C@H]2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N4O2/c23-20(24)17-11-9-16(10-12-17)14-26-22(28)19-8-4-7-18(19)21(27)25-13-15-5-2-1-3-6-15/h1-3,5-6,9-12,18-19H,4,7-8,13-14H2,(H3,23,24)(H,25,27)(H,26,28)/t18-,19-/m1/s1 |
| InChIKey | YIJRRZFKFRHLOW-RTBURBONSA-N |
| XLogP | 2.32 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|