C24H23N3O6 — CID 22862243
trans-(1R,2R)-2-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 22862243) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 22862243 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | trans-(1R,2R)-2-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)[C@@H]4CCC[C@H]4C(=O)O)o3)ccc2c1 |
| InChI | InChI=1S/C24H23N3O6/c25-21(26)15-5-4-14-11-16(7-6-13(14)10-15)33-24(31)20-9-8-17(32-20)12-27-22(28)18-2-1-3-19(18)23(29)30/h4-11,18-19H,1-3,12H2,(H3,25,26)(H,27,28)(H,29,30)/t18-,19-/m1/s1 |
| InChIKey | DCCRCHJGTAVXKS-RTBURBONSA-N |
| XLogP | 3.05 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|