C18H17N3O8 — CID 75987553
2-[[2-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]acetyl]amino]butanedioic acid (PubChem CID 75987553) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is 2-[[2-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 75987553 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-[[2-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]acetyl]amino]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(=O)NC(CC(=O)O)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C18H17N3O8/c19-16(20)9-1-3-10(4-2-9)29-18(27)13-6-5-11(28-13)7-14(22)21-12(17(25)26)8-15(23)24/h1-6,12H,7-8H2,(H3,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | TVFBIHLGSAPFRF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 193.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|