C22H23N3O9S — CID 22398800
4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylamino]-4-oxobutanoic acid;methanesulfonic acid (PubChem CID 22398800) has the molecular formula C22H23N3O9S and a molecular weight of 505.51 g/mol. Its IUPAC name is 4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylamino]-4-oxobutanoic acid;methanesulfonic acid.
| Compound Name | 4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylamino]-4-oxobutanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 22398800 |
| Molecular Formula | C22H23N3O9S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylamino]-4-oxobutanoic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)CCC(=O)O)o3)ccc2c1 |
| InChI | InChI=1S/C21H19N3O6.CH4O3S/c22-20(23)14-2-1-13-10-15(4-3-12(13)9-14)30-21(28)17-6-5-16(29-17)11-24-18(25)7-8-19(26)27;1-5(2,3)4/h1-6,9-10H,7-8,11H2,(H3,22,23)(H,24,25)(H,26,27);1H3,(H,2,3,4) |
| InChIKey | NIBIHSWCYXDLSC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 210.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|