C20H20N2O5S — CID 13176853
(6-carbamimidoylnaphthalen-2-yl) 2-methylbenzoate;methanesulfonic acid (PubChem CID 13176853) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 2-methylbenzoate;methanesulfonic acid.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 2-methylbenzoate;methanesulfonic acid |
|---|---|
| PubChem CID | 13176853 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 2-methylbenzoate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccccc3C)ccc2c1 |
| InChI | InChI=1S/C19H16N2O2.CH4O3S/c1-12-4-2-3-5-17(12)19(22)23-16-9-8-13-10-15(18(20)21)7-6-14(13)11-16;1-5(2,3)4/h2-11H,1H3,(H3,20,21);1H3,(H,2,3,4) |
| InChIKey | AMXYRRJBEFJXDJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|