C28H27N3O7S — CID 13176888
(6-carbamimidoylnaphthalen-2-yl) 4-(phenylmethoxycarbonylaminomethyl)benzoate;methanesulfonic acid (PubChem CID 13176888) has the molecular formula C28H27N3O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 4-(phenylmethoxycarbonylaminomethyl)benzoate;methanesulfonic acid.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 4-(phenylmethoxycarbonylaminomethyl)benzoate;methanesulfonic acid |
|---|---|
| PubChem CID | 13176888 |
| Molecular Formula | C28H27N3O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(phenylmethoxycarbonylaminomethyl)benzoate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)OCc4ccccc4)cc3)ccc2c1 |
| InChI | InChI=1S/C27H23N3O4.CH4O3S/c28-25(29)23-11-10-22-15-24(13-12-21(22)14-23)34-26(31)20-8-6-18(7-9-20)16-30-27(32)33-17-19-4-2-1-3-5-19;1-5(2,3)4/h1-15H,16-17H2,(H3,28,29)(H,30,32);1H3,(H,2,3,4) |
| InChIKey | HXUDEVPQUIGGMR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|