C30H29N3O6 — CID 22398771
(6-carbamimidoylnaphthalen-2-yl) 5-[[[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetyl]amino]methyl]furan-2-carboxylate (PubChem CID 22398771) has the molecular formula C30H29N3O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 5-[[[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetyl]amino]methyl]furan-2-carboxylate.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 5-[[[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetyl]amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 22398771 |
| Molecular Formula | C30H29N3O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 5-[[[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetyl]amino]methyl]furan-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)Cc4ccc(C(=O)OC(C)(C)C)cc4)o3)ccc2c1 |
| InChI | InChI=1S/C30H29N3O6/c1-30(2,3)39-28(35)19-6-4-18(5-7-19)14-26(34)33-17-24-12-13-25(37-24)29(36)38-23-11-10-20-15-22(27(31)32)9-8-21(20)16-23/h4-13,15-16H,14,17H2,1-3H3,(H3,31,32)(H,33,34) |
| InChIKey | ACZMZCRHBZQULP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|