C27H31ClN4O7 — CID 70043875
(6-carbamimidoylnaphthalen-2-yl) 5-[[[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoyl]amino]methyl]furan-2-carboxylate;hydrochloride (PubChem CID 70043875) has the molecular formula C27H31ClN4O7 and a molecular weight of 559.02 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 5-[[[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoyl]amino]methyl]furan-2-carboxylate;hydrochloride.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 5-[[[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoyl]amino]methyl]furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70043875 |
| Molecular Formula | C27H31ClN4O7 |
| Molecular Weight | 559.02 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 5-[[[4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoyl]amino]methyl]furan-2-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)CCC(=O)N(C)C(=O)OC(C)(C)C)o3)ccc2c1 |
| InChI | InChI=1S/C27H30N4O7.ClH/c1-27(2,3)38-26(35)31(4)23(33)12-11-22(32)30-15-20-9-10-21(36-20)25(34)37-19-8-7-16-13-18(24(28)29)6-5-17(16)14-19;/h5-10,13-14H,11-12,15H2,1-4H3,(H3,28,29)(H,30,32);1H |
| InChIKey | XAFQAWBUBIZZQP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.02 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|