C23H26ClN3O5 — CID 70048929
7-amino-7-[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]heptanoic acid;hydrochloride (PubChem CID 70048929) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is 7-amino-7-[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]heptanoic acid;hydrochloride.
| Compound Name | 7-amino-7-[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]heptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70048929 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 7-amino-7-[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]heptanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(C(N)CCCCCC(=O)O)o3)ccc2c1 |
| InChI | InChI=1S/C23H25N3O5.ClH/c24-18(4-2-1-3-5-21(27)28)19-10-11-20(31-19)23(29)30-17-9-8-14-12-16(22(25)26)7-6-15(14)13-17;/h6-13,18H,1-5,24H2,(H3,25,26)(H,27,28);1H |
| InChIKey | FRFSUCVPAYGYCB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|