C27H22ClN3O6 — CID 70044330
3-[4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]phenyl]prop-2-enoic acid;hydrochloride (PubChem CID 70044330) has the molecular formula C27H22ClN3O6 and a molecular weight of 519.94 g/mol. Its IUPAC name is 3-[4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]phenyl]prop-2-enoic acid;hydrochloride.
| Compound Name | 3-[4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]phenyl]prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 70044330 |
| Molecular Formula | C27H22ClN3O6 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 3-[4-[[5-(6-carbamimidoylnaphthalen-2-yl)oxycarbonylfuran-2-yl]methylcarbamoyl]phenyl]prop-2-enoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2cc(OC(=O)c3ccc(CNC(=O)c4ccc(C=CC(=O)O)cc4)o3)ccc2c1 |
| InChI | InChI=1S/C27H21N3O6.ClH/c28-25(29)20-7-6-19-14-21(9-8-18(19)13-20)36-27(34)23-11-10-22(35-23)15-30-26(33)17-4-1-16(2-5-17)3-12-24(31)32;/h1-14H,15H2,(H3,28,29)(H,30,33)(H,31,32);1H |
| InChIKey | MZOKTLMDMWFEOR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|