C19H16N2O4 — CID 152782055
5-[4-(4-carbamimidoylphenoxy)carbonylphenyl]penta-2,4-dienoic acid (PubChem CID 152782055) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 5-[4-(4-carbamimidoylphenoxy)carbonylphenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[4-(4-carbamimidoylphenoxy)carbonylphenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 152782055 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[4-(4-carbamimidoylphenoxy)carbonylphenyl]penta-2,4-dienoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=CC=CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c20-18(21)14-9-11-16(12-10-14)25-19(24)15-7-5-13(6-8-15)3-1-2-4-17(22)23/h1-12H,(H3,20,21)(H,22,23) |
| InChIKey | RXBRYLDKNJHWQW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|