C18H12F4O5 — CID 91006163
3-[4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid (PubChem CID 91006163) has the molecular formula C18H12F4O5 and a molecular weight of 384.28 g/mol. Its IUPAC name is 3-[4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91006163 |
| Molecular Formula | C18H12F4O5 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 3-[4-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]oxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OC(=O)c2ccc(OC(F)(F)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H12F4O5/c19-17(20)18(21,22)27-14-8-4-12(5-9-14)16(25)26-13-6-1-11(2-7-13)3-10-15(23)24/h1-10,17H,(H,23,24) |
| InChIKey | DOQFPSGLSUOTAN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|