C26H22F4N2O5 — CID 87342591
[4-[(E)-3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate (PubChem CID 87342591) has the molecular formula C26H22F4N2O5 and a molecular weight of 518.46 g/mol. Its IUPAC name is [4-[(E)-3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate.
| Compound Name | [4-[(E)-3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
|---|---|
| PubChem CID | 87342591 |
| Molecular Formula | C26H22F4N2O5 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [4-[(E)-3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(1,1,2,2-tetrafluoroethoxy)benzoate |
| SMILES | Nc1ccc(N)c(CCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OC(F)(F)C(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C26H22F4N2O5/c27-25(28)26(29,30)37-21-9-4-17(5-10-21)24(34)36-20-7-1-16(2-8-20)3-12-23(33)35-14-13-18-15-19(31)6-11-22(18)32/h1-12,15,25H,13-14,31-32H2/b12-3+ |
| InChIKey | YSJLYKJRRWUKRX-KGVSQERTSA-N |
| XLogP | 5.11 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|