C26H29F3N2O5 — CID 91095480
[4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 91095480) has the molecular formula C26H29F3N2O5 and a molecular weight of 506.52 g/mol. Its IUPAC name is [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91095480 |
| Molecular Formula | C26H29F3N2O5 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | [4-(2,2,2-trifluoroethoxy)cyclohexyl] 4-[3-[2-(2,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | Nc1ccc(N)c(CCOC(=O)C=Cc2ccc(C(=O)OC3CCC(OCC(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C26H29F3N2O5/c27-26(28,29)16-35-21-7-9-22(10-8-21)36-25(33)18-4-1-17(2-5-18)3-12-24(32)34-14-13-19-15-20(30)6-11-23(19)31/h1-6,11-12,15,21-22H,7-10,13-14,16,30-31H2 |
| InChIKey | YDVPTQOVOHEWNS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|