C25H27F3N2O4 — CID 91586683
[4-(trifluoromethyl)cyclohexyl] 4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 91586683) has the molecular formula C25H27F3N2O4 and a molecular weight of 476.50 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl] 4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | [4-(trifluoromethyl)cyclohexyl] 4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91586683 |
| Molecular Formula | C25H27F3N2O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl] 4-[3-[2-(2,4-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | Nc1ccc(CCOC(=O)C=Cc2ccc(C(=O)OC3CCC(C(F)(F)F)CC3)cc2)c(N)c1 |
| InChI | InChI=1S/C25H27F3N2O4/c26-25(27,28)19-7-10-21(11-8-19)34-24(32)18-4-1-16(2-5-18)3-12-23(31)33-14-13-17-6-9-20(29)15-22(17)30/h1-6,9,12,15,19,21H,7-8,10-11,13-14,29-30H2 |
| InChIKey | KRQGLLKHELUXFM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|