C29H38N2O4 — CID 68611938
(4-hexylcyclohexyl) 4-[(E)-3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 68611938) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is (4-hexylcyclohexyl) 4-[(E)-3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-hexylcyclohexyl) 4-[(E)-3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 68611938 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (4-hexylcyclohexyl) 4-[(E)-3-[(2,4-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCCCCC1CCC(OC(=O)c2ccc(/C=C/C(=O)OCc3ccc(N)cc3N)cc2)CC1 |
| InChI | InChI=1S/C29H38N2O4/c1-2-3-4-5-6-21-9-16-26(17-10-21)35-29(33)23-12-7-22(8-13-23)11-18-28(32)34-20-24-14-15-25(30)19-27(24)31/h7-8,11-15,18-19,21,26H,2-6,9-10,16-17,20,30-31H2,1H3/b18-11+ |
| InChIKey | XAFBUZOCMUYIHY-WOJGMQOQSA-N |
| XLogP | 6.29 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|