C28H36N2O4 — CID 91118983
(4-propylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 91118983) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is (4-propylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-propylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91118983 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | (4-propylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)propoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCC1CCC(OC(=O)c2ccc(C=CC(=O)OCC(C)c3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C28H36N2O4/c1-3-4-20-7-12-26(13-8-20)34-28(32)22-10-5-21(6-11-22)9-14-27(31)33-18-19(2)23-15-24(29)17-25(30)16-23/h5-6,9-11,14-17,19-20,26H,3-4,7-8,12-13,18,29-30H2,1-2H3 |
| InChIKey | JMAHTSFVSPYOEU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|