C32H44N2O4 — CID 91347385
(4-octylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 91347385) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is (4-octylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-octylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 91347385 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | (4-octylcyclohexyl) 4-[3-[2-(3,5-diaminophenyl)ethoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CCCCCCCCC1CCC(OC(=O)c2ccc(C=CC(=O)OCCc3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C32H44N2O4/c1-2-3-4-5-6-7-8-24-11-16-30(17-12-24)38-32(36)27-14-9-25(10-15-27)13-18-31(35)37-20-19-26-21-28(33)23-29(34)22-26/h9-10,13-15,18,21-24,30H,2-8,11-12,16-17,19-20,33-34H2,1H3 |
| InChIKey | PRRVEWINEZWFOE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|