C24H28N2O4 — CID 68610661
(4-methylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate (PubChem CID 68610661) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4-methylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate.
| Compound Name | (4-methylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 68610661 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (4-methylcyclohexyl) 4-[(E)-3-[(3,5-diaminophenyl)methoxy]-3-oxoprop-1-enyl]benzoate |
| SMILES | CC1CCC(OC(=O)c2ccc(/C=C/C(=O)OCc3cc(N)cc(N)c3)cc2)CC1 |
| InChI | InChI=1S/C24H28N2O4/c1-16-2-9-22(10-3-16)30-24(28)19-7-4-17(5-8-19)6-11-23(27)29-15-18-12-20(25)14-21(26)13-18/h4-8,11-14,16,22H,2-3,9-10,15,25-26H2,1H3/b11-6+ |
| InChIKey | GTJVHSDTBISINI-IZZDOVSWSA-N |
| XLogP | 4.34 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|