C14H20N2O2 — CID 61309628
(4-methylcyclohexyl) 3,5-diaminobenzoate (PubChem CID 61309628) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (4-methylcyclohexyl) 3,5-diaminobenzoate.
| Compound Name | (4-methylcyclohexyl) 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 61309628 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (4-methylcyclohexyl) 3,5-diaminobenzoate |
| SMILES | CC1CCC(OC(=O)c2cc(N)cc(N)c2)CC1 |
| InChI | InChI=1S/C14H20N2O2/c1-9-2-4-13(5-3-9)18-14(17)10-6-11(15)8-12(16)7-10/h6-9,13H,2-5,15-16H2,1H3 |
| InChIKey | VYHDYMWDHISXTQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|