C20H23FN2O3 — CID 121404115
[4-[4-(fluoromethoxy)phenyl]cyclohexyl] 3,5-diaminobenzoate (PubChem CID 121404115) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is [4-[4-(fluoromethoxy)phenyl]cyclohexyl] 3,5-diaminobenzoate.
| Compound Name | [4-[4-(fluoromethoxy)phenyl]cyclohexyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 121404115 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | [4-[4-(fluoromethoxy)phenyl]cyclohexyl] 3,5-diaminobenzoate |
| SMILES | Nc1cc(N)cc(C(=O)OC2CCC(c3ccc(OCF)cc3)CC2)c1 |
| InChI | InChI=1S/C20H23FN2O3/c21-12-25-18-5-1-13(2-6-18)14-3-7-19(8-4-14)26-20(24)15-9-16(22)11-17(23)10-15/h1-2,5-6,9-11,14,19H,3-4,7-8,12,22-23H2 |
| InChIKey | YFBPAGCHHVZXQL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|