About cyclopentyl 4-amino-2,6-difluorobenzoate
cyclopentyl 4-amino-2,6-difluorobenzoate (PubChem CID 113348066) has the molecular formula C12H13F2NO2
and a molecular weight of 241.24 g/mol. Its IUPAC name is cyclopentyl 4-amino-2,6-difluorobenzoate.
Molecular Properties
| Compound Name | cyclopentyl 4-amino-2,6-difluorobenzoate |
| PubChem CID | 113348066 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | cyclopentyl 4-amino-2,6-difluorobenzoate |
| SMILES | Nc1cc(F)c(C(=O)OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO2/c13-9-5-7(15)6-10(14)11(9)12(16)17-8-3-1-2-4-8/h5-6,8H,1-4,15H2 |
| InChIKey | VYZOSEVBGYJVST-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl 4-amino-2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 4-amino-2,6-difluorobenzoate?
The IUPAC name of cyclopentyl 4-amino-2,6-difluorobenzoate (CID 113348066) is cyclopentyl 4-amino-2,6-difluorobenzoate.
What is the SMILES notation for cyclopentyl 4-amino-2,6-difluorobenzoate?
The canonical SMILES for cyclopentyl 4-amino-2,6-difluorobenzoate is Nc1cc(F)c(C(=O)OC2CCCC2)c(F)c1.
What is the InChIKey of cyclopentyl 4-amino-2,6-difluorobenzoate?
The InChIKey is VYZOSEVBGYJVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO2/c13-9-5-7(15)6-10(14)11(9)12(16)17-8-3-1-2-4-8/h5-6,8H,1-4,15H2.
What are the key properties of cyclopentyl 4-amino-2,6-difluorobenzoate?
cyclopentyl 4-amino-2,6-difluorobenzoate has a molecular weight of 241.24 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 4-amino-2,6-difluorobenzoate is sourced from PubChem (CID 113348066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).