C11H11F2NO2 — CID 55125527
cyclobutyl 2-amino-4,5-difluorobenzoate (PubChem CID 55125527) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is cyclobutyl 2-amino-4,5-difluorobenzoate.
| Compound Name | cyclobutyl 2-amino-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 55125527 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | cyclobutyl 2-amino-4,5-difluorobenzoate |
| SMILES | Nc1cc(F)c(F)cc1C(=O)OC1CCC1 |
| InChI | InChI=1S/C11H11F2NO2/c12-8-4-7(10(14)5-9(8)13)11(15)16-6-2-1-3-6/h4-6H,1-3,14H2 |
| InChIKey | IXTYSPXKPYNOBL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|