About cyclobutyl 5-amino-2-bromo-4-fluorobenzoate
cyclobutyl 5-amino-2-bromo-4-fluorobenzoate (PubChem CID 62814934) has the molecular formula C11H11BrFNO2
and a molecular weight of 288.12 g/mol. Its IUPAC name is cyclobutyl 5-amino-2-bromo-4-fluorobenzoate.
Molecular Properties
| Compound Name | cyclobutyl 5-amino-2-bromo-4-fluorobenzoate |
| PubChem CID | 62814934 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | cyclobutyl 5-amino-2-bromo-4-fluorobenzoate |
| SMILES | Nc1cc(C(=O)OC2CCC2)c(Br)cc1F |
| InChI | InChI=1S/C11H11BrFNO2/c12-8-5-9(13)10(14)4-7(8)11(15)16-6-2-1-3-6/h4-6H,1-3,14H2 |
| InChIKey | RPQCKBFOPWDBEO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyl 5-amino-2-bromo-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl 5-amino-2-bromo-4-fluorobenzoate?
The IUPAC name of cyclobutyl 5-amino-2-bromo-4-fluorobenzoate (CID 62814934) is cyclobutyl 5-amino-2-bromo-4-fluorobenzoate.
What is the SMILES notation for cyclobutyl 5-amino-2-bromo-4-fluorobenzoate?
The canonical SMILES for cyclobutyl 5-amino-2-bromo-4-fluorobenzoate is Nc1cc(C(=O)OC2CCC2)c(Br)cc1F.
What is the InChIKey of cyclobutyl 5-amino-2-bromo-4-fluorobenzoate?
The InChIKey is RPQCKBFOPWDBEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO2/c12-8-5-9(13)10(14)4-7(8)11(15)16-6-2-1-3-6/h4-6H,1-3,14H2.
What are the key properties of cyclobutyl 5-amino-2-bromo-4-fluorobenzoate?
cyclobutyl 5-amino-2-bromo-4-fluorobenzoate has a molecular weight of 288.12 g/mol, XLogP of 2.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 5-amino-2-bromo-4-fluorobenzoate is sourced from PubChem (CID 62814934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).