About (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate
(4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate (PubChem CID 62814938) has the molecular formula C14H10BrF2NO2
and a molecular weight of 342.14 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate |
| PubChem CID | 62814938 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate |
| SMILES | Nc1cc(C(=O)OCc2ccc(F)cc2)c(Br)cc1F |
| InChI | InChI=1S/C14H10BrF2NO2/c15-11-6-12(17)13(18)5-10(11)14(19)20-7-8-1-3-9(16)4-2-8/h1-6H,7,18H2 |
| InChIKey | PTCZRCYNVRYVJH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate?
The IUPAC name of (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate (CID 62814938) is (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate.
What is the SMILES notation for (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate?
The canonical SMILES for (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate is Nc1cc(C(=O)OCc2ccc(F)cc2)c(Br)cc1F.
What is the InChIKey of (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate?
The InChIKey is PTCZRCYNVRYVJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2NO2/c15-11-6-12(17)13(18)5-10(11)14(19)20-7-8-1-3-9(16)4-2-8/h1-6H,7,18H2.
What are the key properties of (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate?
(4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate has a molecular weight of 342.14 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 5-amino-2-bromo-4-fluorobenzoate is sourced from PubChem (CID 62814938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).