C14H10BrF2NO2 — CID 104700330
(4-bromophenyl)methyl 4-amino-2,5-difluorobenzoate (PubChem CID 104700330) has the molecular formula C14H10BrF2NO2 and a molecular weight of 342.14 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-amino-2,5-difluorobenzoate.
| Compound Name | (4-bromophenyl)methyl 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 104700330 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (4-bromophenyl)methyl 4-amino-2,5-difluorobenzoate |
| SMILES | Nc1cc(F)c(C(=O)OCc2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C14H10BrF2NO2/c15-9-3-1-8(2-4-9)7-20-14(19)10-5-12(17)13(18)6-11(10)16/h1-6H,7,18H2 |
| InChIKey | MXSODQUBEHZNRK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|