About (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate
(4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate (PubChem CID 27190942) has the molecular formula C15H11BrFNO3
and a molecular weight of 352.16 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate |
| PubChem CID | 27190942 |
| Molecular Formula | C15H11BrFNO3 |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate |
| SMILES | NC(=O)c1ccc(COC(=O)c2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C15H11BrFNO3/c16-11-5-6-12(13(17)7-11)15(20)21-8-9-1-3-10(4-2-9)14(18)19/h1-7H,8H2,(H2,18,19) |
| InChIKey | DJBPICNZLANDAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate?
The IUPAC name of (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate (CID 27190942) is (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate.
What is the SMILES notation for (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate?
The canonical SMILES for (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate is NC(=O)c1ccc(COC(=O)c2ccc(Br)cc2F)cc1.
What is the InChIKey of (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate?
The InChIKey is DJBPICNZLANDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrFNO3/c16-11-5-6-12(13(17)7-11)15(20)21-8-9-1-3-10(4-2-9)14(18)19/h1-7H,8H2,(H2,18,19).
What are the key properties of (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate?
(4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate has a molecular weight of 352.16 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamoylphenyl)methyl 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 27190942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).