C15H13F2NO3 — CID 104700445
(4-methoxyphenyl)methyl 4-amino-2,5-difluorobenzoate (PubChem CID 104700445) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-amino-2,5-difluorobenzoate.
| Compound Name | (4-methoxyphenyl)methyl 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 104700445 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-amino-2,5-difluorobenzoate |
| SMILES | COc1ccc(COC(=O)c2cc(F)c(N)cc2F)cc1 |
| InChI | InChI=1S/C15H13F2NO3/c1-20-10-4-2-9(3-5-10)8-21-15(19)11-6-13(17)14(18)7-12(11)16/h2-7H,8,18H2,1H3 |
| InChIKey | KIORGRZRNPQDCH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|