C15H12F3NO2 — CID 114348605
(4-fluoro-2-methylphenyl)methyl 4-amino-2,5-difluorobenzoate (PubChem CID 114348605) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is (4-fluoro-2-methylphenyl)methyl 4-amino-2,5-difluorobenzoate.
| Compound Name | (4-fluoro-2-methylphenyl)methyl 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 114348605 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (4-fluoro-2-methylphenyl)methyl 4-amino-2,5-difluorobenzoate |
| SMILES | Cc1cc(F)ccc1COC(=O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C15H12F3NO2/c1-8-4-10(16)3-2-9(8)7-21-15(20)11-5-13(18)14(19)6-12(11)17/h2-6H,7,19H2,1H3 |
| InChIKey | FXEBBFFKVUZBFE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|