C15H12BrF2NO2 — CID 107873911
(2,4-difluorophenyl)methyl 3-amino-5-bromo-2-methylbenzoate (PubChem CID 107873911) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl 3-amino-5-bromo-2-methylbenzoate.
| Compound Name | (2,4-difluorophenyl)methyl 3-amino-5-bromo-2-methylbenzoate |
|---|---|
| PubChem CID | 107873911 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2,4-difluorophenyl)methyl 3-amino-5-bromo-2-methylbenzoate |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)OCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12BrF2NO2/c1-8-12(4-10(16)5-14(8)19)15(20)21-7-9-2-3-11(17)6-13(9)18/h2-6H,7,19H2,1H3 |
| InChIKey | DLHYQJSBGBQCHA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|