C10H11BrN2O3 — CID 107873717
(2-amino-2-oxoethyl) 3-amino-5-bromo-2-methylbenzoate (PubChem CID 107873717) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-amino-5-bromo-2-methylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-amino-5-bromo-2-methylbenzoate |
|---|---|
| PubChem CID | 107873717 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-amino-5-bromo-2-methylbenzoate |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)OCC(N)=O |
| InChI | InChI=1S/C10H11BrN2O3/c1-5-7(2-6(11)3-8(5)12)10(15)16-4-9(13)14/h2-3H,4,12H2,1H3,(H2,13,14) |
| InChIKey | MBWLCUFEQHHIJB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|