C17H18BrNO2 — CID 107873811
(3,4-dimethylphenyl)methyl 3-amino-5-bromo-2-methylbenzoate (PubChem CID 107873811) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methyl 3-amino-5-bromo-2-methylbenzoate.
| Compound Name | (3,4-dimethylphenyl)methyl 3-amino-5-bromo-2-methylbenzoate |
|---|---|
| PubChem CID | 107873811 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (3,4-dimethylphenyl)methyl 3-amino-5-bromo-2-methylbenzoate |
| SMILES | Cc1ccc(COC(=O)c2cc(Br)cc(N)c2C)cc1C |
| InChI | InChI=1S/C17H18BrNO2/c1-10-4-5-13(6-11(10)2)9-21-17(20)15-7-14(18)8-16(19)12(15)3/h4-8H,9,19H2,1-3H3 |
| InChIKey | YQHRAIALZCHUQA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|