About (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate
(3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate (PubChem CID 107873852) has the molecular formula C14H17BrN2O2
and a molecular weight of 325.21 g/mol. Its IUPAC name is (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate.
Molecular Properties
| Compound Name | (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate |
| PubChem CID | 107873852 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)OCCC(C)(C)C#N |
| InChI | InChI=1S/C14H17BrN2O2/c1-9-11(6-10(15)7-12(9)17)13(18)19-5-4-14(2,3)8-16/h6-7H,4-5,17H2,1-3H3 |
| InChIKey | FQXIEPZMIPZZCO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate?
The IUPAC name of (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate (CID 107873852) is (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate.
What is the SMILES notation for (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate?
The canonical SMILES for (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate is Cc1c(N)cc(Br)cc1C(=O)OCCC(C)(C)C#N.
What is the InChIKey of (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate?
The InChIKey is FQXIEPZMIPZZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN2O2/c1-9-11(6-10(15)7-12(9)17)13(18)19-5-4-14(2,3)8-16/h6-7H,4-5,17H2,1-3H3.
What are the key properties of (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate?
(3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate has a molecular weight of 325.21 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-3-methylbutyl) 3-amino-5-bromo-2-methylbenzoate is sourced from PubChem (CID 107873852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).